C18H18F3NO5S — CID 155170791
[3-[2-oxo-2-(trifluoromethylsulfonylamino)ethyl]naphthalen-1-yl] 2,2-dimethylpropanoate (PubChem CID 155170791) has the molecular formula C18H18F3NO5S and a molecular weight of 417.41 g/mol. Its IUPAC name is [3-[2-oxo-2-(trifluoromethylsulfonylamino)ethyl]naphthalen-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-[2-oxo-2-(trifluoromethylsulfonylamino)ethyl]naphthalen-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 155170791 |
| Molecular Formula | C18H18F3NO5S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | [3-[2-oxo-2-(trifluoromethylsulfonylamino)ethyl]naphthalen-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)Oc1cc(CC(=O)NS(=O)(=O)C(F)(F)F)cc2ccccc12 |
| InChI | InChI=1S/C18H18F3NO5S/c1-17(2,3)16(24)27-14-9-11(8-12-6-4-5-7-13(12)14)10-15(23)22-28(25,26)18(19,20)21/h4-9H,10H2,1-3H3,(H,22,23) |
| InChIKey | GCARCYZUEHNCFO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|