C19H23F3N2O5 — CID 158277628
(4-methoxynaphthalen-2-yl) (2S)-2,5-diamino-2-methylpentanoate;2,2,2-trifluoroacetic acid (PubChem CID 158277628) has the molecular formula C19H23F3N2O5 and a molecular weight of 416.40 g/mol. Its IUPAC name is (4-methoxynaphthalen-2-yl) (2S)-2,5-diamino-2-methylpentanoate;2,2,2-trifluoroacetic acid.
| Compound Name | (4-methoxynaphthalen-2-yl) (2S)-2,5-diamino-2-methylpentanoate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158277628 |
| Molecular Formula | C19H23F3N2O5 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | (4-methoxynaphthalen-2-yl) (2S)-2,5-diamino-2-methylpentanoate;2,2,2-trifluoroacetic acid |
| SMILES | COc1cc(OC(=O)[C@@](C)(N)CCCN)cc2ccccc12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H22N2O3.C2HF3O2/c1-17(19,8-5-9-18)16(20)22-13-10-12-6-3-4-7-14(12)15(11-13)21-2;3-2(4,5)1(6)7/h3-4,6-7,10-11H,5,8-9,18-19H2,1-2H3;(H,6,7)/t17-;/m0./s1 |
| InChIKey | GJUOPIOEIGYWTL-LMOVPXPDSA-N |
| XLogP | 2.84 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|