C18H6F14O4 — CID 91745994
[4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)naphthalen-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91745994) has the molecular formula C18H6F14O4 and a molecular weight of 552.21 g/mol. Its IUPAC name is [4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)naphthalen-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)naphthalen-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91745994 |
| Molecular Formula | C18H6F14O4 |
| Molecular Weight | 552.21 g/mol |
| Exact Mass | 552.00 |
| IUPAC Name | [4-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)naphthalen-2-yl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(Oc1cc(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)c2ccccc2c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H6F14O4/c19-13(20,15(23,24)17(27,28)29)11(33)35-8-5-7-3-1-2-4-9(7)10(6-8)36-12(34)14(21,22)16(25,26)18(30,31)32/h1-6H |
| InChIKey | AAROEXLQESRVAK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.21 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|