C10H4ClF7O2 — CID 91742559
(3-chlorophenyl) 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 91742559) has the molecular formula C10H4ClF7O2 and a molecular weight of 324.58 g/mol. Its IUPAC name is (3-chlorophenyl) 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | (3-chlorophenyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 91742559 |
| Molecular Formula | C10H4ClF7O2 |
| Molecular Weight | 324.58 g/mol |
| Exact Mass | 323.98 |
| IUPAC Name | (3-chlorophenyl) 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(Oc1cccc(Cl)c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H4ClF7O2/c11-5-2-1-3-6(4-5)20-7(19)8(12,13)9(14,15)10(16,17)18/h1-4H |
| InChIKey | JTYHYRBWKFYRMF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.58 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|