C10H4ClF6O3- — CID 167333709
2-(3-chlorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate (PubChem CID 167333709) has the molecular formula C10H4ClF6O3- and a molecular weight of 321.58 g/mol. Its IUPAC name is 2-(3-chlorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate.
| Compound Name | 2-(3-chlorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate |
|---|---|
| PubChem CID | 167333709 |
| Molecular Formula | C10H4ClF6O3- |
| Molecular Weight | 321.58 g/mol |
| Exact Mass | 320.98 |
| IUPAC Name | 2-(3-chlorophenoxy)carbonyl-1,1,1,3,3,3-hexafluoropropan-2-olate |
| SMILES | O=C(Oc1cccc(Cl)c1)C([O-])(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H4ClF6O3/c11-5-2-1-3-6(4-5)20-7(18)8(19,9(12,13)14)10(15,16)17/h1-4H/q-1 |
| InChIKey | VJPKJVYBPWFGOS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.58 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|