C19H20ClF2NO4 — CID 155026157
(3-chlorophenyl) 2,2-difluoro-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate (PubChem CID 155026157) has the molecular formula C19H20ClF2NO4 and a molecular weight of 399.82 g/mol. Its IUPAC name is (3-chlorophenyl) 2,2-difluoro-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate.
| Compound Name | (3-chlorophenyl) 2,2-difluoro-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate |
|---|---|
| PubChem CID | 155026157 |
| Molecular Formula | C19H20ClF2NO4 |
| Molecular Weight | 399.82 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | (3-chlorophenyl) 2,2-difluoro-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate |
| SMILES | COc1ccc(CNC(C)C(O)C(F)(F)C(=O)Oc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C19H20ClF2NO4/c1-12(23-11-13-6-8-15(26-2)9-7-13)17(24)19(21,22)18(25)27-16-5-3-4-14(20)10-16/h3-10,12,17,23-24H,11H2,1-2H3 |
| InChIKey | VKFQTFKPWLJBKU-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|