About methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane
methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane (PubChem CID 162160332) has the molecular formula C14H23NO4S
and a molecular weight of 301.41 g/mol. Its IUPAC name is methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane.
Molecular Properties
| Compound Name | methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane |
| PubChem CID | 162160332 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane |
| SMILES | COC(=O)CC(O)[C@H](C)NCc1ccc(OC)cc1.S |
| InChI | InChI=1S/C14H21NO4.H2S/c1-10(13(16)8-14(17)19-3)15-9-11-4-6-12(18-2)7-5-11;/h4-7,10,13,15-16H,8-9H2,1-3H3;1H2/t10-,13?;/m0./s1 |
| InChIKey | ZMJSANSCAPABCX-WPYJPOKUSA-N |
| XLogP | 1.21 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane?
The IUPAC name of methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane (CID 162160332) is methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane.
What is the SMILES notation for methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane?
The canonical SMILES for methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane is COC(=O)CC(O)[C@H](C)NCc1ccc(OC)cc1.S.
What is the InChIKey of methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane?
The InChIKey is ZMJSANSCAPABCX-WPYJPOKUSA-N. The full InChI is InChI=1S/C14H21NO4.H2S/c1-10(13(16)8-14(17)19-3)15-9-11-4-6-12(18-2)7-5-11;/h4-7,10,13,15-16H,8-9H2,1-3H3;1H2/t10-,13?;/m0./s1.
What are the key properties of methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane?
methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane has a molecular weight of 301.41 g/mol, XLogP of 1.21, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S)-3-hydroxy-4-[(4-methoxyphenyl)methylamino]pentanoate;sulfane is sourced from PubChem (CID 162160332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).