C12H17NO5 — CID 20646788
4,4-dihydroxy-3-[(4-methoxyphenyl)methylamino]butanoic acid (PubChem CID 20646788) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4,4-dihydroxy-3-[(4-methoxyphenyl)methylamino]butanoic acid.
| Compound Name | 4,4-dihydroxy-3-[(4-methoxyphenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 20646788 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | 4,4-dihydroxy-3-[(4-methoxyphenyl)methylamino]butanoic acid |
| SMILES | COc1ccc(CNC(CC(=O)O)C(O)O)cc1 |
| InChI | InChI=1S/C12H17NO5/c1-18-9-4-2-8(3-5-9)7-13-10(12(16)17)6-11(14)15/h2-5,10,12-13,16-17H,6-7H2,1H3,(H,14,15) |
| InChIKey | HCNKXEHAAPWGPN-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|