C16H13Cl4NO3 — CID 1014610
(3-chlorophenyl) N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]carbamate (PubChem CID 1014610) has the molecular formula C16H13Cl4NO3 and a molecular weight of 409.10 g/mol. Its IUPAC name is (3-chlorophenyl) N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]carbamate.
| Compound Name | (3-chlorophenyl) N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]carbamate |
|---|---|
| PubChem CID | 1014610 |
| Molecular Formula | C16H13Cl4NO3 |
| Molecular Weight | 409.10 g/mol |
| Exact Mass | 406.96 |
| IUPAC Name | (3-chlorophenyl) N-[(1S)-2,2,2-trichloro-1-(4-methoxyphenyl)ethyl]carbamate |
| SMILES | COc1ccc([C@H](NC(=O)Oc2cccc(Cl)c2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C16H13Cl4NO3/c1-23-12-7-5-10(6-8-12)14(16(18,19)20)21-15(22)24-13-4-2-3-11(17)9-13/h2-9,14H,1H3,(H,21,22)/t14-/m0/s1 |
| InChIKey | GHMFMXHBGARTGS-AWEZNQCLSA-N |
| XLogP | 5.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.10 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|