C22H28ClNO3 — CID 94027354
(2R)-2-(3-chlorophenoxy)-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]butanamide (PubChem CID 94027354) has the molecular formula C22H28ClNO3 and a molecular weight of 389.92 g/mol. Its IUPAC name is (2R)-2-(3-chlorophenoxy)-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]butanamide.
| Compound Name | (2R)-2-(3-chlorophenoxy)-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]butanamide |
|---|---|
| PubChem CID | 94027354 |
| Molecular Formula | C22H28ClNO3 |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | (2R)-2-(3-chlorophenoxy)-N-[(1S)-1-(4-methoxyphenyl)-3-methylbutyl]butanamide |
| SMILES | CC[C@@H](Oc1cccc(Cl)c1)C(=O)N[C@@H](CC(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H28ClNO3/c1-5-21(27-19-8-6-7-17(23)14-19)22(25)24-20(13-15(2)3)16-9-11-18(26-4)12-10-16/h6-12,14-15,20-21H,5,13H2,1-4H3,(H,24,25)/t20-,21+/m0/s1 |
| InChIKey | VWPMAJIHIMJLOW-LEWJYISDSA-N |
| XLogP | 5.41 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |