C23H30ClNO3 — CID 132662163
2-(4-chloro-3-methylphenoxy)-N-[1-(4-methoxyphenyl)-3-methylbutyl]butanamide (PubChem CID 132662163) has the molecular formula C23H30ClNO3 and a molecular weight of 403.95 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[1-(4-methoxyphenyl)-3-methylbutyl]butanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[1-(4-methoxyphenyl)-3-methylbutyl]butanamide |
|---|---|
| PubChem CID | 132662163 |
| Molecular Formula | C23H30ClNO3 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[1-(4-methoxyphenyl)-3-methylbutyl]butanamide |
| SMILES | CCC(Oc1ccc(Cl)c(C)c1)C(=O)NC(CC(C)C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C23H30ClNO3/c1-6-22(28-19-11-12-20(24)16(4)14-19)23(26)25-21(13-15(2)3)17-7-9-18(27-5)10-8-17/h7-12,14-15,21-22H,6,13H2,1-5H3,(H,25,26) |
| InChIKey | LMBZICSLFBCVDE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |