C17H10ClF7O2 — CID 101487808
[(3-chlorophenyl)-phenylmethyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 101487808) has the molecular formula C17H10ClF7O2 and a molecular weight of 414.70 g/mol. Its IUPAC name is [(3-chlorophenyl)-phenylmethyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [(3-chlorophenyl)-phenylmethyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 101487808 |
| Molecular Formula | C17H10ClF7O2 |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.03 |
| IUPAC Name | [(3-chlorophenyl)-phenylmethyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | O=C(OC(c1ccccc1)c1cccc(Cl)c1)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H10ClF7O2/c18-12-8-4-7-11(9-12)13(10-5-2-1-3-6-10)27-14(26)15(19,20)16(21,22)17(23,24)25/h1-9,13H |
| InChIKey | ZXEIPTXUBMKVOX-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|