C12H7F7O3 — CID 146010600
[3-(2,2,3,3,4,4,4-heptafluorobutanoyl)phenyl] acetate (PubChem CID 146010600) has the molecular formula C12H7F7O3 and a molecular weight of 332.17 g/mol. Its IUPAC name is [3-(2,2,3,3,4,4,4-heptafluorobutanoyl)phenyl] acetate.
| Compound Name | [3-(2,2,3,3,4,4,4-heptafluorobutanoyl)phenyl] acetate |
|---|---|
| PubChem CID | 146010600 |
| Molecular Formula | C12H7F7O3 |
| Molecular Weight | 332.17 g/mol |
| Exact Mass | 332.03 |
| IUPAC Name | [3-(2,2,3,3,4,4,4-heptafluorobutanoyl)phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C(=O)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C12H7F7O3/c1-6(20)22-8-4-2-3-7(5-8)9(21)10(13,14)11(15,16)12(17,18)19/h2-5H,1H3 |
| InChIKey | RNUUBIYLVBXYCB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|