C28H34N2O5 — CID 149437573
6-O-tert-butyl 1-O-(4-methoxynaphthalen-2-yl) (2S)-5-amino-2-(benzylamino)hexanedioate (PubChem CID 149437573) has the molecular formula C28H34N2O5 and a molecular weight of 478.59 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-(4-methoxynaphthalen-2-yl) (2S)-5-amino-2-(benzylamino)hexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-(4-methoxynaphthalen-2-yl) (2S)-5-amino-2-(benzylamino)hexanedioate |
|---|---|
| PubChem CID | 149437573 |
| Molecular Formula | C28H34N2O5 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.25 |
| IUPAC Name | 6-O-tert-butyl 1-O-(4-methoxynaphthalen-2-yl) (2S)-5-amino-2-(benzylamino)hexanedioate |
| SMILES | COc1cc(OC(=O)[C@H](CCC(N)C(=O)OC(C)(C)C)NCc2ccccc2)cc2ccccc12 |
| InChI | InChI=1S/C28H34N2O5/c1-28(2,3)35-26(31)23(29)14-15-24(30-18-19-10-6-5-7-11-19)27(32)34-21-16-20-12-8-9-13-22(20)25(17-21)33-4/h5-13,16-17,23-24,30H,14-15,18,29H2,1-4H3/t23?,24-/m0/s1 |
| InChIKey | GULTVYMMHDHMMH-CGAIIQECSA-N |
| XLogP | 4.36 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|