C21H29N3O3 — CID 149437578
tert-butyl (5S)-2-amino-5-(methylamino)-6-(naphthalen-2-ylamino)-6-oxohexanoate (PubChem CID 149437578) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is tert-butyl (5S)-2-amino-5-(methylamino)-6-(naphthalen-2-ylamino)-6-oxohexanoate.
| Compound Name | tert-butyl (5S)-2-amino-5-(methylamino)-6-(naphthalen-2-ylamino)-6-oxohexanoate |
|---|---|
| PubChem CID | 149437578 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | tert-butyl (5S)-2-amino-5-(methylamino)-6-(naphthalen-2-ylamino)-6-oxohexanoate |
| SMILES | CN[C@@H](CCC(N)C(=O)OC(C)(C)C)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H29N3O3/c1-21(2,3)27-20(26)17(22)11-12-18(23-4)19(25)24-16-10-9-14-7-5-6-8-15(14)13-16/h5-10,13,17-18,23H,11-12,22H2,1-4H3,(H,24,25)/t17?,18-/m0/s1 |
| InChIKey | JWZVKXGRFFSVJU-ZVAWYAOSSA-N |
| XLogP | 2.82 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |