C12H11F3O5S — CID 174860134
[2,4-dimethyl-6-(trifluoromethylsulfonyloxy)phenyl] prop-2-enoate (PubChem CID 174860134) has the molecular formula C12H11F3O5S and a molecular weight of 324.28 g/mol. Its IUPAC name is [2,4-dimethyl-6-(trifluoromethylsulfonyloxy)phenyl] prop-2-enoate.
| Compound Name | [2,4-dimethyl-6-(trifluoromethylsulfonyloxy)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 174860134 |
| Molecular Formula | C12H11F3O5S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | [2,4-dimethyl-6-(trifluoromethylsulfonyloxy)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1c(C)cc(C)cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3O5S/c1-4-10(16)19-11-8(3)5-7(2)6-9(11)20-21(17,18)12(13,14)15/h4-6H,1H2,2-3H3 |
| InChIKey | CXYMXLHWEGGGGE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|