C30H32BrNO7 — CID 172972902
[1',1',3',3'-tetramethyl-8-(2-methylprop-2-enoyloxymethyl)-6-nitrospiro[chromene-2,2'-indene]-5'-yl] 2-bromo-2-methylpropanoate (PubChem CID 172972902) has the molecular formula C30H32BrNO7 and a molecular weight of 598.49 g/mol. Its IUPAC name is [1',1',3',3'-tetramethyl-8-(2-methylprop-2-enoyloxymethyl)-6-nitrospiro[chromene-2,2'-indene]-5'-yl] 2-bromo-2-methylpropanoate.
| Compound Name | [1',1',3',3'-tetramethyl-8-(2-methylprop-2-enoyloxymethyl)-6-nitrospiro[chromene-2,2'-indene]-5'-yl] 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 172972902 |
| Molecular Formula | C30H32BrNO7 |
| Molecular Weight | 598.49 g/mol |
| Exact Mass | 597.14 |
| IUPAC Name | [1',1',3',3'-tetramethyl-8-(2-methylprop-2-enoyloxymethyl)-6-nitrospiro[chromene-2,2'-indene]-5'-yl] 2-bromo-2-methylpropanoate |
| SMILES | C=C(C)C(=O)OCc1cc([N+](=O)[O-])cc2c1OC1(C=C2)C(C)(C)c2ccc(OC(=O)C(C)(C)Br)cc2C1(C)C |
| InChI | InChI=1S/C30H32BrNO7/c1-17(2)25(33)37-16-19-14-20(32(35)36)13-18-11-12-30(39-24(18)19)27(3,4)22-10-9-21(15-23(22)28(30,5)6)38-26(34)29(7,8)31/h9-15H,1,16H2,2-8H3 |
| InChIKey | LMLRXZZPEAFVAL-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|