C35H32N2O7 — CID 176636725
[(2R)-5'-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl] bicyclo[2.2.1]hepta-1(7),5-diene-2-carboxylate (PubChem CID 176636725) has the molecular formula C35H32N2O7 and a molecular weight of 592.65 g/mol. Its IUPAC name is [(2R)-5'-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl] bicyclo[2.2.1]hepta-1(7),5-diene-2-carboxylate.
| Compound Name | [(2R)-5'-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl] bicyclo[2.2.1]hepta-1(7),5-diene-2-carboxylate |
|---|---|
| PubChem CID | 176636725 |
| Molecular Formula | C35H32N2O7 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | [(2R)-5'-(bicyclo[2.2.1]hept-5-ene-2-carbonyloxy)-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]-8-yl] bicyclo[2.2.1]hepta-1(7),5-diene-2-carboxylate |
| SMILES | CN1c2ccc(OC(=O)C3CC4C=CC3C4)cc2C(C)(C)[C@]12C=Cc1cc([N+](=O)[O-])cc(OC(=O)C3CC4C=CC3=C4)c1O2 |
| InChI | InChI=1S/C35H32N2O7/c1-34(2)28-18-25(42-32(38)26-14-19-4-6-21(26)12-19)8-9-29(28)36(3)35(34)11-10-23-16-24(37(40)41)17-30(31(23)44-35)43-33(39)27-15-20-5-7-22(27)13-20/h4-11,13,16-21,26-27H,12,14-15H2,1-3H3/t19?,20?,21?,26?,27?,35-/m1/s1 |
| InChIKey | XBTCACHGMRVHBK-GVUTWWMRSA-N |
| XLogP | 6.28 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|