C31H34N2O7 — CID 122389408
(14Z)-2,2,32-trimethyl-24-nitro-8,21,29-trioxa-32-azapentacyclo[20.6.2.11,4.13,7.026,30]dotriaconta-3,5,7(31),14,22,24,26(30),27-octaene-9,20-dione (PubChem CID 122389408) has the molecular formula C31H34N2O7 and a molecular weight of 546.62 g/mol. Its IUPAC name is (14Z)-2,2,32-trimethyl-24-nitro-8,21,29-trioxa-32-azapentacyclo[20.6.2.11,4.13,7.026,30]dotriaconta-3,5,7(31),14,22,24,26(30),27-octaene-9,20-dione.
| Compound Name | (14Z)-2,2,32-trimethyl-24-nitro-8,21,29-trioxa-32-azapentacyclo[20.6.2.11,4.13,7.026,30]dotriaconta-3,5,7(31),14,22,24,26(30),27-octaene-9,20-dione |
|---|---|
| PubChem CID | 122389408 |
| Molecular Formula | C31H34N2O7 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | (14Z)-2,2,32-trimethyl-24-nitro-8,21,29-trioxa-32-azapentacyclo[20.6.2.11,4.13,7.026,30]dotriaconta-3,5,7(31),14,22,24,26(30),27-octaene-9,20-dione |
| SMILES | CN1c2ccc3cc2C(C)(C)C12C=Cc1cc([N+](=O)[O-])cc(c1O2)OC(=O)CCCC/C=C\CCCCC(=O)O3 |
| InChI | InChI=1S/C31H34N2O7/c1-30(2)24-20-23-14-15-25(24)32(3)31(30)17-16-21-18-22(33(36)37)19-26(29(21)40-31)39-28(35)13-11-9-7-5-4-6-8-10-12-27(34)38-23/h4-5,14-20H,6-13H2,1-3H3/b5-4- |
| InChIKey | KASDHYCAQMHLBS-PLNGDYQASA-N |
| XLogP | 6.63 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|