C40H58N4O2+2 — CID 159286039
4-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-1-ium-2-yl]ethenyl]-6-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]hex-4-enoate (PubChem CID 159286039) has the molecular formula C40H58N4O2+2 and a molecular weight of 626.93 g/mol. Its IUPAC name is 4-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-1-ium-2-yl]ethenyl]-6-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]hex-4-enoate.
| Compound Name | 4-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-1-ium-2-yl]ethenyl]-6-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]hex-4-enoate |
|---|---|
| PubChem CID | 159286039 |
| Molecular Formula | C40H58N4O2+2 |
| Molecular Weight | 626.93 g/mol |
| Exact Mass | 626.45 |
| IUPAC Name | 4-[2-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-1-ium-2-yl]ethenyl]-6-[3,3-dimethyl-1-[3-(trimethylazaniumyl)propyl]indol-2-ylidene]hex-4-enoate |
| SMILES | CC1(C)C(=CC=C(C=CC2=[N+](CCC[N+](C)(C)C)c3ccccc3C2(C)C)CCC(=O)[O-])N(CCC[N+](C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C40H58N4O2/c1-39(2)32-17-11-13-19-34(32)41(27-15-29-43(5,6)7)36(39)24-21-31(23-26-38(45)46)22-25-37-40(3,4)33-18-12-14-20-35(33)42(37)28-16-30-44(8,9)10/h11-14,17-22,24-25H,15-16,23,26-30H2,1-10H3/q+2 |
| InChIKey | KZNCFWQZPOUGTO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.93 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|