C19H20NO2+ — CID 102138335
4-hydroxy-6-[2-(1,3,3-trimethyl-1H-indol-1-ium-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one (PubChem CID 102138335) has the molecular formula C19H20NO2+ and a molecular weight of 294.37 g/mol. Its IUPAC name is 4-hydroxy-6-[2-(1,3,3-trimethyl-1H-indol-1-ium-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one.
| Compound Name | 4-hydroxy-6-[2-(1,3,3-trimethyl-1H-indol-1-ium-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 102138335 |
| Molecular Formula | C19H20NO2+ |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 4-hydroxy-6-[2-(1,3,3-trimethyl-1H-indol-1-ium-2-ylidene)ethylidene]cyclohexa-2,4-dien-1-one |
| SMILES | C[NH+]1C(=CC=C2C=C(O)C=CC2=O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C19H19NO2/c1-19(2)15-6-4-5-7-16(15)20(3)18(19)11-8-13-12-14(21)9-10-17(13)22/h4-12,21H,1-3H3/p+1 |
| InChIKey | BYSAZWICZOANEX-UHFFFAOYSA-O |
| XLogP | 2.52 |
| TPSA | 41.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|