C26H34N2O4 — CID 6434224
diethyl-[2-(3-ethyl-3-phenyl-2H-indol-1-yl)ethyl]azanium;(E)-4-hydroxy-4-oxobut-2-enoate (PubChem CID 6434224) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is diethyl-[2-(3-ethyl-3-phenyl-2H-indol-1-yl)ethyl]azanium;(E)-4-hydroxy-4-oxobut-2-enoate.
| Compound Name | diethyl-[2-(3-ethyl-3-phenyl-2H-indol-1-yl)ethyl]azanium;(E)-4-hydroxy-4-oxobut-2-enoate |
|---|---|
| PubChem CID | 6434224 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | diethyl-[2-(3-ethyl-3-phenyl-2H-indol-1-yl)ethyl]azanium;(E)-4-hydroxy-4-oxobut-2-enoate |
| SMILES | CC[NH+](CC)CCN1CC(CC)(c2ccccc2)c2ccccc21.O=C([O-])/C=C/C(=O)O |
| InChI | InChI=1S/C22H30N2.C4H4O4/c1-4-22(19-12-8-7-9-13-19)18-24(17-16-23(5-2)6-3)21-15-11-10-14-20(21)22;5-3(6)1-2-4(7)8/h7-15H,4-6,16-18H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | KYRQLNHCIYPISQ-WLHGVMLRSA-N |
| XLogP | 1.50 |
| TPSA | 85.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|