C25H31N2+ — CID 176780302
(2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethyl-1,2-dihydroindol-1-ium-2-yl)prop-2-enylidene]indole (PubChem CID 176780302) has the molecular formula C25H31N2+ and a molecular weight of 359.54 g/mol. Its IUPAC name is (2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethyl-1,2-dihydroindol-1-ium-2-yl)prop-2-enylidene]indole.
| Compound Name | (2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethyl-1,2-dihydroindol-1-ium-2-yl)prop-2-enylidene]indole |
|---|---|
| PubChem CID | 176780302 |
| Molecular Formula | C25H31N2+ |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (2Z)-1,3,3-trimethyl-2-[(E)-3-(1,3,3-trimethyl-1,2-dihydroindol-1-ium-2-yl)prop-2-enylidene]indole |
| SMILES | CN1/C(=C\C=C\C2[NH+](C)c3ccccc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C25H30N2/c1-24(2)18-12-7-9-14-20(18)26(5)22(24)16-11-17-23-25(3,4)19-13-8-10-15-21(19)27(23)6/h7-17,22H,1-6H3/p+1/b16-11+,23-17- |
| InChIKey | NHLGTFXJAPLESH-CSMLLFHVSA-O |
| XLogP | 4.36 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|