C27H33N2+ — CID 59039935
1,3,3-trimethyl-2-[5-(1,3,3-trimethyl-3a,7a-dihydroindol-1-ium-2-yl)penta-2,4-dienylidene]indole (PubChem CID 59039935) has the molecular formula C27H33N2+ and a molecular weight of 385.58 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[5-(1,3,3-trimethyl-3a,7a-dihydroindol-1-ium-2-yl)penta-2,4-dienylidene]indole.
| Compound Name | 1,3,3-trimethyl-2-[5-(1,3,3-trimethyl-3a,7a-dihydroindol-1-ium-2-yl)penta-2,4-dienylidene]indole |
|---|---|
| PubChem CID | 59039935 |
| Molecular Formula | C27H33N2+ |
| Molecular Weight | 385.58 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | 1,3,3-trimethyl-2-[5-(1,3,3-trimethyl-3a,7a-dihydroindol-1-ium-2-yl)penta-2,4-dienylidene]indole |
| SMILES | CN1C(=CC=CC=CC2=[N+](C)C3C=CC=CC3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C27H33N2/c1-26(2)20-14-10-12-16-22(20)28(5)24(26)18-8-7-9-19-25-27(3,4)21-15-11-13-17-23(21)29(25)6/h7-20,22H,1-6H3/q+1 |
| InChIKey | BEUCHQMRRQDAEA-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.58 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|