C19H24INO2S — CID 173351588
5-(benzenesulfonyl)-1-ethyl-2,3,3-trimethyl-2H-indole;hydroiodide (PubChem CID 173351588) has the molecular formula C19H24INO2S and a molecular weight of 457.38 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-1-ethyl-2,3,3-trimethyl-2H-indole;hydroiodide.
| Compound Name | 5-(benzenesulfonyl)-1-ethyl-2,3,3-trimethyl-2H-indole;hydroiodide |
|---|---|
| PubChem CID | 173351588 |
| Molecular Formula | C19H24INO2S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 5-(benzenesulfonyl)-1-ethyl-2,3,3-trimethyl-2H-indole;hydroiodide |
| SMILES | CCN1c2ccc(S(=O)(=O)c3ccccc3)cc2C(C)(C)C1C.I |
| InChI | InChI=1S/C19H23NO2S.HI/c1-5-20-14(2)19(3,4)17-13-16(11-12-18(17)20)23(21,22)15-9-7-6-8-10-15;/h6-14H,5H2,1-4H3;1H |
| InChIKey | OHHUMSBUDGKVNU-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|