C21H25NO6S2-2 — CID 44629459
(2E)-3,3-dimethyl-2-[(2E,4E,6E)-4-methylocta-2,4,6-trienylidene]-1-(2-sulfonatoethyl)indole-5-sulfonate (PubChem CID 44629459) has the molecular formula C21H25NO6S2-2 and a molecular weight of 451.57 g/mol. Its IUPAC name is (2E)-3,3-dimethyl-2-[(2E,4E,6E)-4-methylocta-2,4,6-trienylidene]-1-(2-sulfonatoethyl)indole-5-sulfonate.
| Compound Name | (2E)-3,3-dimethyl-2-[(2E,4E,6E)-4-methylocta-2,4,6-trienylidene]-1-(2-sulfonatoethyl)indole-5-sulfonate |
|---|---|
| PubChem CID | 44629459 |
| Molecular Formula | C21H25NO6S2-2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.11 |
| IUPAC Name | (2E)-3,3-dimethyl-2-[(2E,4E,6E)-4-methylocta-2,4,6-trienylidene]-1-(2-sulfonatoethyl)indole-5-sulfonate |
| SMILES | C/C=C/C=C(C)/C=C/C=C1/N(CCS(=O)(=O)[O-])c2ccc(S(=O)(=O)[O-])cc2C1(C)C |
| InChI | InChI=1S/C21H27NO6S2/c1-5-6-8-16(2)9-7-10-20-21(3,4)18-15-17(30(26,27)28)11-12-19(18)22(20)13-14-29(23,24)25/h5-12,15H,13-14H2,1-4H3,(H,23,24,25)(H,26,27,28)/p-2/b6-5+,9-7+,16-8+,20-10+ |
| InChIKey | JYCUOIARRQGYBX-XIFBKRLLSA-L |
| XLogP | 3.20 |
| TPSA | 117.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|