C21H27NO3S — CID 141113115
4-(1-benzyl-2,3-dimethyl-2H-indol-3-yl)butane-1-sulfonic acid (PubChem CID 141113115) has the molecular formula C21H27NO3S and a molecular weight of 373.52 g/mol. Its IUPAC name is 4-(1-benzyl-2,3-dimethyl-2H-indol-3-yl)butane-1-sulfonic acid.
| Compound Name | 4-(1-benzyl-2,3-dimethyl-2H-indol-3-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 141113115 |
| Molecular Formula | C21H27NO3S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 4-(1-benzyl-2,3-dimethyl-2H-indol-3-yl)butane-1-sulfonic acid |
| SMILES | CC1N(Cc2ccccc2)c2ccccc2C1(C)CCCCS(=O)(=O)O |
| InChI | InChI=1S/C21H27NO3S/c1-17-21(2,14-8-9-15-26(23,24)25)19-12-6-7-13-20(19)22(17)16-18-10-4-3-5-11-18/h3-7,10-13,17H,8-9,14-16H2,1-2H3,(H,23,24,25) |
| InChIKey | WIWBRGQLPVJPSB-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|