C20H29NO3S — CID 58511978
4-(4,4,4a-trimethyl-2-methylidene-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid (PubChem CID 58511978) has the molecular formula C20H29NO3S and a molecular weight of 363.52 g/mol. Its IUPAC name is 4-(4,4,4a-trimethyl-2-methylidene-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid.
| Compound Name | 4-(4,4,4a-trimethyl-2-methylidene-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 58511978 |
| Molecular Formula | C20H29NO3S |
| Molecular Weight | 363.52 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 4-(4,4,4a-trimethyl-2-methylidene-3,9a-dihydro-1H-carbazol-9-yl)butane-1-sulfonic acid |
| SMILES | C=C1CC2N(CCCCS(=O)(=O)O)c3ccccc3C2(C)C(C)(C)C1 |
| InChI | InChI=1S/C20H29NO3S/c1-15-13-18-20(4,19(2,3)14-15)16-9-5-6-10-17(16)21(18)11-7-8-12-25(22,23)24/h5-6,9-10,18H,1,7-8,11-14H2,2-4H3,(H,22,23,24) |
| InChIKey | OHAICMLRHFFQDB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.52 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|