C18H23NO3S — CID 87416607
4-(1,1-dimethyl-2H-benzo[e]indol-3-yl)butane-1-sulfonic acid (PubChem CID 87416607) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 4-(1,1-dimethyl-2H-benzo[e]indol-3-yl)butane-1-sulfonic acid.
| Compound Name | 4-(1,1-dimethyl-2H-benzo[e]indol-3-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 87416607 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 4-(1,1-dimethyl-2H-benzo[e]indol-3-yl)butane-1-sulfonic acid |
| SMILES | CC1(C)CN(CCCCS(=O)(=O)O)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C18H23NO3S/c1-18(2)13-19(11-5-6-12-23(20,21)22)16-10-9-14-7-3-4-8-15(14)17(16)18/h3-4,7-10H,5-6,11-13H2,1-2H3,(H,20,21,22) |
| InChIKey | PKVITMBFIOZYQN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|