C18H20NO4S- — CID 2326833
4-(1,1-dimethyl-2-oxobenzo[e]indol-3-yl)butane-1-sulfonate (PubChem CID 2326833) has the molecular formula C18H20NO4S- and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-(1,1-dimethyl-2-oxobenzo[e]indol-3-yl)butane-1-sulfonate.
| Compound Name | 4-(1,1-dimethyl-2-oxobenzo[e]indol-3-yl)butane-1-sulfonate |
|---|---|
| PubChem CID | 2326833 |
| Molecular Formula | C18H20NO4S- |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | 4-(1,1-dimethyl-2-oxobenzo[e]indol-3-yl)butane-1-sulfonate |
| SMILES | CC1(C)C(=O)N(CCCCS(=O)(=O)[O-])c2ccc3ccccc3c21 |
| InChI | InChI=1S/C18H21NO4S/c1-18(2)16-14-8-4-3-7-13(14)9-10-15(16)19(17(18)20)11-5-6-12-24(21,22)23/h3-4,7-10H,5-6,11-12H2,1-2H3,(H,21,22,23)/p-1 |
| InChIKey | AORLHYGMJYDEHR-UHFFFAOYSA-M |
| XLogP | 2.79 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|