C28H26N2O4S — CID 58852825
3-(1,1-dimethylspiro[benzo[e]indole-2,3'-benzo[f][1,4]benzoxazine]-3-yl)propane-1-sulfonic acid (PubChem CID 58852825) has the molecular formula C28H26N2O4S and a molecular weight of 486.59 g/mol. Its IUPAC name is 3-(1,1-dimethylspiro[benzo[e]indole-2,3'-benzo[f][1,4]benzoxazine]-3-yl)propane-1-sulfonic acid.
| Compound Name | 3-(1,1-dimethylspiro[benzo[e]indole-2,3'-benzo[f][1,4]benzoxazine]-3-yl)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 58852825 |
| Molecular Formula | C28H26N2O4S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 3-(1,1-dimethylspiro[benzo[e]indole-2,3'-benzo[f][1,4]benzoxazine]-3-yl)propane-1-sulfonic acid |
| SMILES | CC1(C)c2c(ccc3ccccc23)N(CCCS(=O)(=O)O)C12C=Nc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C28H26N2O4S/c1-27(2)25-21-10-5-3-8-19(21)12-14-23(25)30(16-7-17-35(31,32)33)28(27)18-29-26-22-11-6-4-9-20(22)13-15-24(26)34-28/h3-6,8-15,18H,7,16-17H2,1-2H3,(H,31,32,33) |
| InChIKey | GLCSPSCTUUEVBQ-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|