C27H26N2O3 — CID 14618270
2-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)ethyl 2-methylprop-2-enoate (PubChem CID 14618270) has the molecular formula C27H26N2O3 and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 14618270 |
| Molecular Formula | C27H26N2O3 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.19 |
| IUPAC Name | 2-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCN1c2ccccc2C(C)(C)C12C=Nc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C27H26N2O3/c1-18(2)25(30)31-16-15-29-22-12-8-7-11-21(22)26(3,4)27(29)17-28-24-20-10-6-5-9-19(20)13-14-23(24)32-27/h5-14,17H,1,15-16H2,2-4H3 |
| InChIKey | AYPHRVWKCYQQDY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|