C47H41N3O4 — CID 101336818
(3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)methyl 3-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)propanoate (PubChem CID 101336818) has the molecular formula C47H41N3O4 and a molecular weight of 711.86 g/mol. Its IUPAC name is (3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)methyl 3-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)propanoate.
| Compound Name | (3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)methyl 3-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)propanoate |
|---|---|
| PubChem CID | 101336818 |
| Molecular Formula | C47H41N3O4 |
| Molecular Weight | 711.86 g/mol |
| Exact Mass | 711.31 |
| IUPAC Name | (3',3'-dimethylspiro[benzo[f]chromene-3,2'-indole]-1'-yl)methyl 3-(3',3'-dimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-1'-yl)propanoate |
| SMILES | CC1(C)c2ccccc2N(COC(=O)CCN2c3ccccc3C(C)(C)C23C=Nc2c(ccc4ccccc24)O3)C12C=Cc1c(ccc3ccccc13)O2 |
| InChI | InChI=1S/C47H41N3O4/c1-44(2)37-18-10-12-20-39(37)50(46(44)27-25-35-33-15-7-5-13-31(33)21-23-40(35)53-46)30-52-42(51)26-28-49-38-19-11-9-17-36(38)45(3,4)47(49)29-48-43-34-16-8-6-14-32(34)22-24-41(43)54-47/h5-25,27,29H,26,28,30H2,1-4H3 |
| InChIKey | FXWNULZQDDAQTQ-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.86 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |