sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)

C32H40N2O4S — CID 173168480

IUPACsulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)
SMILESCC1N(C)c2ccc3ccccc3c2C1(C)C.CC1N(C)c2ccc3ccccc3c2C1(C)C.O=S(=O)(O)O
InChIInChI=1S/2C16H19N.H2O4S/c2*1-11-16(2,3)15-13-8-6-5-7-12(13)9-10-14(15)17(11)4;1-5(2,3)4/h2*5-11H,1-4H3;(H2,1,2,3,4)
InChIKeyZLOMIGNGFVOYLF-UHFFFAOYSA-N
MW548.75 g/mol
LogP7.26
Rot. Bonds

About sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)

sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) (PubChem CID 173168480) has the molecular formula C32H40N2O4S and a molecular weight of 548.75 g/mol. Its IUPAC name is sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole).

Molecular Properties

Compound Namesulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)
PubChem CID173168480
Molecular FormulaC32H40N2O4S
Molecular Weight548.75 g/mol
Exact Mass548.27
IUPAC Namesulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)
SMILESCC1N(C)c2ccc3ccccc3c2C1(C)C.CC1N(C)c2ccc3ccccc3c2C1(C)C.O=S(=O)(O)O
InChIInChI=1S/2C16H19N.H2O4S/c2*1-11-16(2,3)15-13-8-6-5-7-12(13)9-10-14(15)17(11)4;1-5(2,3)4/h2*5-11H,1-4H3;(H2,1,2,3,4)
InChIKeyZLOMIGNGFVOYLF-UHFFFAOYSA-N
XLogP7.26
TPSA81.08 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms39
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500548.75
LogP ≤ 57.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)?
The IUPAC name of sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) (CID 173168480) is sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole).
What is the SMILES notation for sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)?
The canonical SMILES for sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) is CC1N(C)c2ccc3ccccc3c2C1(C)C.CC1N(C)c2ccc3ccccc3c2C1(C)C.O=S(=O)(O)O.
What is the InChIKey of sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)?
The InChIKey is ZLOMIGNGFVOYLF-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H19N.H2O4S/c2*1-11-16(2,3)15-13-8-6-5-7-12(13)9-10-14(15)17(11)4;1-5(2,3)4/h2*5-11H,1-4H3;(H2,1,2,3,4).
What are the key properties of sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole)?
sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) has a molecular weight of 548.75 g/mol, XLogP of 7.26, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) is sourced from PubChem (CID 173168480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).