C32H40N2O4S — CID 173168480
sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) (PubChem CID 173168480) has the molecular formula C32H40N2O4S and a molecular weight of 548.75 g/mol. Its IUPAC name is sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole).
| Compound Name | sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) |
|---|---|
| PubChem CID | 173168480 |
| Molecular Formula | C32H40N2O4S |
| Molecular Weight | 548.75 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | sulfuric acid;bis(1,1,2,3-tetramethyl-2H-benzo[e]indole) |
| SMILES | CC1N(C)c2ccc3ccccc3c2C1(C)C.CC1N(C)c2ccc3ccccc3c2C1(C)C.O=S(=O)(O)O |
| InChI | InChI=1S/2C16H19N.H2O4S/c2*1-11-16(2,3)15-13-8-6-5-7-12(13)9-10-14(15)17(11)4;1-5(2,3)4/h2*5-11H,1-4H3;(H2,1,2,3,4) |
| InChIKey | ZLOMIGNGFVOYLF-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|