About (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole
(2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole (PubChem CID 21138647) has the molecular formula C17H19N
and a molecular weight of 237.35 g/mol. Its IUPAC name is (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole.
Molecular Properties
| Compound Name | (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole |
| PubChem CID | 21138647 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole |
| SMILES | C/C=C1/N(C)c2ccc3ccccc3c2C1(C)C |
| InChI | InChI=1S/C17H19N/c1-5-15-17(2,3)16-13-9-7-6-8-12(13)10-11-14(16)18(15)4/h5-11H,1-4H3/b15-5+ |
| InChIKey | IXQNKCXNUDHNFF-PJQLUOCWSA-N |
| XLogP | 4.47 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole?
The IUPAC name of (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole (CID 21138647) is (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole.
What is the SMILES notation for (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole?
The canonical SMILES for (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole is C/C=C1/N(C)c2ccc3ccccc3c2C1(C)C.
What is the InChIKey of (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole?
The InChIKey is IXQNKCXNUDHNFF-PJQLUOCWSA-N. The full InChI is InChI=1S/C17H19N/c1-5-15-17(2,3)16-13-9-7-6-8-12(13)10-11-14(16)18(15)4/h5-11H,1-4H3/b15-5+.
What are the key properties of (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole?
(2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole has a molecular weight of 237.35 g/mol, XLogP of 4.47, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-ethylidene-1,1,3-trimethylbenzo[e]indole is sourced from PubChem (CID 21138647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).