C37H36N2O3-2 — CID 140604004
4-oxo-2,5-bis[(Z)-(1,1,3-trimethylbenzo[e]indol-2-ylidene)methyl]cyclopentane-1,3-diolate (PubChem CID 140604004) has the molecular formula C37H36N2O3-2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 4-oxo-2,5-bis[(Z)-(1,1,3-trimethylbenzo[e]indol-2-ylidene)methyl]cyclopentane-1,3-diolate.
| Compound Name | 4-oxo-2,5-bis[(Z)-(1,1,3-trimethylbenzo[e]indol-2-ylidene)methyl]cyclopentane-1,3-diolate |
|---|---|
| PubChem CID | 140604004 |
| Molecular Formula | C37H36N2O3-2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.27 |
| IUPAC Name | 4-oxo-2,5-bis[(Z)-(1,1,3-trimethylbenzo[e]indol-2-ylidene)methyl]cyclopentane-1,3-diolate |
| SMILES | CN1/C(=C\C2C(=O)C([O-])C(/C=C3\N(C)c4ccc5ccccc5c4C3(C)C)C2[O-])C(C)(C)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C37H36N2O3/c1-36(2)29(38(5)27-17-15-21-11-7-9-13-23(21)31(27)36)19-25-33(40)26(35(42)34(25)41)20-30-37(3,4)32-24-14-10-8-12-22(24)16-18-28(32)39(30)6/h7-20,25-26,33-34H,1-6H3/q-2/b29-19-,30-20- |
| InChIKey | GNRKPFYAGSGPDA-NAZWXXJZSA-N |
| XLogP | 5.19 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |