C22H31NO5S — CID 88883473
4-[4,4-dimethyl-2-oxo-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid (PubChem CID 88883473) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is 4-[4,4-dimethyl-2-oxo-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid.
| Compound Name | 4-[4,4-dimethyl-2-oxo-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 88883473 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 4-[4,4-dimethyl-2-oxo-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid |
| SMILES | CC1(C)CC(=O)CC2N(CCCCS(=O)(=O)O)c3ccccc3C21CCCC=O |
| InChI | InChI=1S/C22H31NO5S/c1-21(2)16-17(25)15-20-22(21,11-5-7-13-24)18-9-3-4-10-19(18)23(20)12-6-8-14-29(26,27)28/h3-4,9-10,13,20H,5-8,11-12,14-16H2,1-2H3,(H,26,27,28) |
| InChIKey | RVZQVOLCNTXOCY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|