C15H23NO6S2 — CID 175853622
2,3,3-trimethyl-1-(4-sulfobutyl)-2H-indol-1-ium-1-sulfonate (PubChem CID 175853622) has the molecular formula C15H23NO6S2 and a molecular weight of 377.48 g/mol. Its IUPAC name is 2,3,3-trimethyl-1-(4-sulfobutyl)-2H-indol-1-ium-1-sulfonate.
| Compound Name | 2,3,3-trimethyl-1-(4-sulfobutyl)-2H-indol-1-ium-1-sulfonate |
|---|---|
| PubChem CID | 175853622 |
| Molecular Formula | C15H23NO6S2 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | 2,3,3-trimethyl-1-(4-sulfobutyl)-2H-indol-1-ium-1-sulfonate |
| SMILES | CC1C(C)(C)c2ccccc2[N+]1(CCCCS(=O)(=O)O)S(=O)(=O)[O-] |
| InChI | InChI=1S/C15H23NO6S2/c1-12-15(2,3)13-8-4-5-9-14(13)16(12,24(20,21)22)10-6-7-11-23(17,18)19/h4-5,8-9,12H,6-7,10-11H2,1-3H3,(H-,17,18,19,20,21,22) |
| InChIKey | YONNMWQGPHOKNY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 111.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|