C21H27NO8S2 — CID 154313819
6-(2,3,3-trimethyl-5,7-disulfo-2H-benzo[g]indol-1-yl)hexanoic acid (PubChem CID 154313819) has the molecular formula C21H27NO8S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is 6-(2,3,3-trimethyl-5,7-disulfo-2H-benzo[g]indol-1-yl)hexanoic acid.
| Compound Name | 6-(2,3,3-trimethyl-5,7-disulfo-2H-benzo[g]indol-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 154313819 |
| Molecular Formula | C21H27NO8S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 6-(2,3,3-trimethyl-5,7-disulfo-2H-benzo[g]indol-1-yl)hexanoic acid |
| SMILES | CC1N(CCCCCC(=O)O)c2c(cc(S(=O)(=O)O)c3cc(S(=O)(=O)O)ccc23)C1(C)C |
| InChI | InChI=1S/C21H27NO8S2/c1-13-21(2,3)17-12-18(32(28,29)30)16-11-14(31(25,26)27)8-9-15(16)20(17)22(13)10-6-4-5-7-19(23)24/h8-9,11-13H,4-7,10H2,1-3H3,(H,23,24)(H,25,26,27)(H,28,29,30) |
| InChIKey | NBAIOFZIYFNIPZ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 149.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|