C21H26NO8S2+ — CID 150114016
6-(1,3,3-trimethyl-6,8-disulfobenzo[g]indol-1-ium-2-yl)hexanoic acid (PubChem CID 150114016) has the molecular formula C21H26NO8S2+ and a molecular weight of 484.57 g/mol. Its IUPAC name is 6-(1,3,3-trimethyl-6,8-disulfobenzo[g]indol-1-ium-2-yl)hexanoic acid.
| Compound Name | 6-(1,3,3-trimethyl-6,8-disulfobenzo[g]indol-1-ium-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 150114016 |
| Molecular Formula | C21H26NO8S2+ |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 6-(1,3,3-trimethyl-6,8-disulfobenzo[g]indol-1-ium-2-yl)hexanoic acid |
| SMILES | C[N+]1=C(CCCCCC(=O)O)C(C)(C)c2ccc3c(S(=O)(=O)O)cc(S(=O)(=O)O)cc3c21 |
| InChI | InChI=1S/C21H25NO8S2/c1-21(2)16-10-9-14-15(11-13(31(25,26)27)12-17(14)32(28,29)30)20(16)22(3)18(21)7-5-4-6-8-19(23)24/h9-12H,4-8H2,1-3H3,(H2-,23,24,25,26,27,28,29,30)/p+1 |
| InChIKey | DXVYAYFTGURXHX-UHFFFAOYSA-O |
| XLogP | 3.37 |
| TPSA | 149.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|