C40H43N2O11S3+ — CID 171765040
6-[(2E)-1,1-dimethyl-8-sulfo-2-[(2E,4E)-5-(1,1,3-trimethyl-6,8-disulfobenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanoic acid (PubChem CID 171765040) has the molecular formula C40H43N2O11S3+ and a molecular weight of 823.99 g/mol. Its IUPAC name is 6-[(2E)-1,1-dimethyl-8-sulfo-2-[(2E,4E)-5-(1,1,3-trimethyl-6,8-disulfobenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanoic acid.
| Compound Name | 6-[(2E)-1,1-dimethyl-8-sulfo-2-[(2E,4E)-5-(1,1,3-trimethyl-6,8-disulfobenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 171765040 |
| Molecular Formula | C40H43N2O11S3+ |
| Molecular Weight | 823.99 g/mol |
| Exact Mass | 823.20 |
| IUPAC Name | 6-[(2E)-1,1-dimethyl-8-sulfo-2-[(2E,4E)-5-(1,1,3-trimethyl-6,8-disulfobenzo[e]indol-3-ium-2-yl)penta-2,4-dienylidene]benzo[e]indol-3-yl]hexanoic acid |
| SMILES | C[N+]1=C(/C=C/C=C/C=C2/N(CCCCCC(=O)O)c3ccc4ccc(S(=O)(=O)O)cc4c3C2(C)C)C(C)(C)c2c1ccc1c(S(=O)(=O)O)cc(S(=O)(=O)O)cc21 |
| InChI | InChI=1S/C40H42N2O11S3/c1-39(2)34(41(5)31-20-18-28-30(38(31)39)23-27(55(48,49)50)24-33(28)56(51,52)53)12-8-6-9-13-35-40(3,4)37-29-22-26(54(45,46)47)17-15-25(29)16-19-32(37)42(35)21-11-7-10-14-36(43)44/h6,8-9,12-13,15-20,22-24H,7,10-11,14,21H2,1-5H3,(H3-,43,44,45,46,47,48,49,50,51,52,53)/p+1 |
| InChIKey | FDQOJQSXOLWNQM-UHFFFAOYSA-O |
| XLogP | 7.18 |
| TPSA | 206.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.99 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|