C28H34N2O5S — CID 87581025
6-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid (PubChem CID 87581025) has the molecular formula C28H34N2O5S and a molecular weight of 510.66 g/mol. Its IUPAC name is 6-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid.
| Compound Name | 6-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 87581025 |
| Molecular Formula | C28H34N2O5S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 6-[2-[(1E,3E,5E)-6-anilinohexa-1,3,5-trienyl]-3,3-dimethyl-5-sulfo-2H-indol-1-yl]hexanoic acid |
| SMILES | CC1(C)c2cc(S(=O)(=O)O)ccc2N(CCCCCC(=O)O)C1/C=C/C=C/C=C/Nc1ccccc1 |
| InChI | InChI=1S/C28H34N2O5S/c1-28(2)24-21-23(36(33,34)35)17-18-25(24)30(20-12-6-10-16-27(31)32)26(28)15-9-3-4-11-19-29-22-13-7-5-8-14-22/h3-5,7-9,11,13-15,17-19,21,26,29H,6,10,12,16,20H2,1-2H3,(H,31,32)(H,33,34,35)/b4-3+,15-9+,19-11+ |
| InChIKey | XSOYQJPJPYJOKZ-SVFXTJDPSA-N |
| XLogP | 5.78 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|