C27H37N3O — CID 164938741
3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-5-(diethylamino)-3,3-dimethyl-2H-indol-1-yl]propan-1-ol (PubChem CID 164938741) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-5-(diethylamino)-3,3-dimethyl-2H-indol-1-yl]propan-1-ol.
| Compound Name | 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-5-(diethylamino)-3,3-dimethyl-2H-indol-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 164938741 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-5-(diethylamino)-3,3-dimethyl-2H-indol-1-yl]propan-1-ol |
| SMILES | CCN(CC)c1ccc2c(c1)C(C)(C)C(/C=C/C=C/Nc1ccccc1)N2CCCO |
| InChI | InChI=1S/C27H37N3O/c1-5-29(6-2)23-16-17-25-24(21-23)27(3,4)26(30(25)19-12-20-31)15-10-11-18-28-22-13-8-7-9-14-22/h7-11,13-18,21,26,28,31H,5-6,12,19-20H2,1-4H3/b15-10+,18-11+ |
| InChIKey | UEOSQHHOFZPVHQ-MIKCAUBTSA-N |
| XLogP | 5.56 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|