C32H42N4O5 — CID 23980658
(5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23980658) has the molecular formula C32H42N4O5 and a molecular weight of 562.71 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23980658 |
| Molecular Formula | C32H42N4O5 |
| Molecular Weight | 562.71 g/mol |
| Exact Mass | 562.32 |
| IUPAC Name | (5R,6R,7R)-2-N-[4-(diethylamino)phenyl]-7-ethyl-3-(4-hydroxybutyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCCCO)C(=O)[C@@H]3[C@@H](C(=O)Nc4ccccc4)[C@@]4(CC)CCC23O4)cc1 |
| InChI | InChI=1S/C32H42N4O5/c1-4-31-18-19-32(41-31)26(25(31)28(38)33-22-12-8-7-9-13-22)30(40)36(20-10-11-21-37)27(32)29(39)34-23-14-16-24(17-15-23)35(5-2)6-3/h7-9,12-17,25-27,37H,4-6,10-11,18-21H2,1-3H3,(H,33,38)(H,34,39)/t25-,26-,27?,31+,32?/m0/s1 |
| InChIKey | DRHKSDDJXHSKLA-OFFCGTLFSA-N |
| XLogP | 4.04 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.71 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|