C29H34ClN3O5 — CID 23924761
(5R,6R,7R)-2-N-(4-chlorophenyl)-7-ethyl-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924761) has the molecular formula C29H34ClN3O5 and a molecular weight of 540.06 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(4-chlorophenyl)-7-ethyl-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(4-chlorophenyl)-7-ethyl-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924761 |
| Molecular Formula | C29H34ClN3O5 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (5R,6R,7R)-2-N-(4-chlorophenyl)-7-ethyl-3-(5-hydroxypentyl)-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CC[C@]12CCC3(O1)C(C(=O)Nc1ccc(Cl)cc1)N(CCCCCO)C(=O)[C@@H]3[C@H]2C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C29H34ClN3O5/c1-2-28-15-16-29(38-28)23(22(28)25(35)31-20-9-5-3-6-10-20)27(37)33(17-7-4-8-18-34)24(29)26(36)32-21-13-11-19(30)12-14-21/h3,5-6,9-14,22-24,34H,2,4,7-8,15-18H2,1H3,(H,31,35)(H,32,36)/t22-,23-,24?,28+,29?/m0/s1 |
| InChIKey | VANWZQCSGWNHLK-PFINFNDISA-N |
| XLogP | 4.23 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|