C31H38ClN3O6 — CID 23924385
(5R,6S,7S)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23924385) has the molecular formula C31H38ClN3O6 and a molecular weight of 584.11 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23924385 |
| Molecular Formula | C31H38ClN3O6 |
| Molecular Weight | 584.11 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | (5R,6S,7S)-2-N-(4-chlorophenyl)-6-N-(4-ethoxyphenyl)-3-(6-hydroxyhexyl)-7-methyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCCCCCO)C(C(=O)Nc4ccc(Cl)cc4)C34CC[C@]2(C)O4)cc1 |
| InChI | InChI=1S/C31H38ClN3O6/c1-3-40-23-14-12-22(13-15-23)33-27(37)24-25-29(39)35(18-6-4-5-7-19-36)26(31(25)17-16-30(24,2)41-31)28(38)34-21-10-8-20(32)9-11-21/h8-15,24-26,36H,3-7,16-19H2,1-2H3,(H,33,37)(H,34,38)/t24-,25+,26?,30+,31?/m1/s1 |
| InChIKey | JPMWJSKRYIKRLU-KFJQEDMNSA-N |
| XLogP | 4.63 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.11 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|