C32H49N3O6 — CID 23782543
(5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23782543) has the molecular formula C32H49N3O6 and a molecular weight of 571.76 g/mol. Its IUPAC name is (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23782543 |
| Molecular Formula | C32H49N3O6 |
| Molecular Weight | 571.76 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | (5R,6S,7S)-6-N-(4-ethoxyphenyl)-3-(5-hydroxypentyl)-7-methyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@H]2[C@H]3C(=O)N(CCCCCO)C(C(=O)NC(C)(C)CC(C)(C)C)C34CC[C@]2(C)O4)cc1 |
| InChI | InChI=1S/C32H49N3O6/c1-8-40-22-14-12-21(13-15-22)33-26(37)23-24-28(39)35(18-10-9-11-19-36)25(32(24)17-16-31(23,7)41-32)27(38)34-30(5,6)20-29(2,3)4/h12-15,23-25,36H,8-11,16-20H2,1-7H3,(H,33,37)(H,34,38)/t23-,24+,25?,31+,32?/m1/s1 |
| InChIKey | PNBDOKLDHGCWAF-BIMVKIMGSA-N |
| XLogP | 4.28 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.76 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|