C31H47N3O6 — CID 23755445
(5R,6R,7R)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23755445) has the molecular formula C31H47N3O6 and a molecular weight of 557.73 g/mol. Its IUPAC name is (5R,6R,7R)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23755445 |
| Molecular Formula | C31H47N3O6 |
| Molecular Weight | 557.73 g/mol |
| Exact Mass | 557.35 |
| IUPAC Name | (5R,6R,7R)-6-N-(4-ethoxyphenyl)-3-(3-hydroxypropyl)-7,8-dimethyl-4-oxo-2-N-(2,4,4-trimethylpentan-2-yl)-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)[C@@H]2[C@H]3C(=O)N(CCCO)C(C(=O)NC(C)(C)CC(C)(C)C)C34CC(C)[C@@]2(C)O4)cc1 |
| InChI | InChI=1S/C31H47N3O6/c1-9-39-21-13-11-20(12-14-21)32-25(36)22-23-27(38)34(15-10-16-35)24(31(23)17-19(2)30(22,8)40-31)26(37)33-29(6,7)18-28(3,4)5/h11-14,19,22-24,35H,9-10,15-18H2,1-8H3,(H,32,36)(H,33,37)/t19?,22-,23-,24?,30+,31?/m0/s1 |
| InChIKey | QBSCHUKGGMNNGD-HLQKHZIPSA-N |
| XLogP | 3.75 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.73 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |