C29H44N4O5 — CID 23755149
(5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23755149) has the molecular formula C29H44N4O5 and a molecular weight of 528.69 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23755149 |
| Molecular Formula | C29H44N4O5 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | (5R,6S,7S)-2-N-[4-(diethylamino)phenyl]-3-(6-hydroxyhexyl)-6-N,7,8-trimethyl-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2N(CCCCCCO)C(=O)[C@@H]3[C@H](C(=O)NC)[C@@]4(C)OC23CC4C)cc1 |
| InChI | InChI=1S/C29H44N4O5/c1-6-32(7-2)21-14-12-20(13-15-21)31-26(36)24-29-18-19(3)28(4,38-29)22(25(35)30-5)23(29)27(37)33(24)16-10-8-9-11-17-34/h12-15,19,22-24,34H,6-11,16-18H2,1-5H3,(H,30,35)(H,31,36)/t19?,22-,23+,24?,28+,29?/m1/s1 |
| InChIKey | MYAIKZXNVONYTM-KMDXWXLNSA-N |
| XLogP | 2.78 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|