C29H34ClN3O5 — CID 23842372
(5R,6R,7R)-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23842372) has the molecular formula C29H34ClN3O5 and a molecular weight of 540.06 g/mol. Its IUPAC name is (5R,6R,7R)-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6R,7R)-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23842372 |
| Molecular Formula | C29H34ClN3O5 |
| Molecular Weight | 540.06 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | (5R,6R,7R)-2-N-(2-chloro-6-methylphenyl)-3-(4-hydroxybutyl)-7,8-dimethyl-4-oxo-6-N-phenyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | Cc1cccc(Cl)c1NC(=O)C1N(CCCCO)C(=O)[C@@H]2[C@@H](C(=O)Nc3ccccc3)[C@]3(C)OC12CC3C |
| InChI | InChI=1S/C29H34ClN3O5/c1-17-10-9-13-20(30)23(17)32-26(36)24-29-16-18(2)28(3,38-29)21(25(35)31-19-11-5-4-6-12-19)22(29)27(37)33(24)14-7-8-15-34/h4-6,9-13,18,21-22,24,34H,7-8,14-16H2,1-3H3,(H,31,35)(H,32,36)/t18?,21-,22-,24?,28+,29?/m0/s1 |
| InChIKey | CXWWCMYYFWTIIY-AXVJQGDXSA-N |
| XLogP | 4.01 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.06 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|